7-ETHYL-5-(2-METHOXY-ETHYLAMINO)-2H-[1,2,4]TRIAZOLO[4,3-C]PYRIMIDIN-3-ONE

pro_cas
pro_cdbregno
CCD03265156
pro_formula
C10 H15 N5 O2
pro_molWeight
237.262

basic_info

Product_Name: 7-ETHYL-5-(2-METHOXY-ETHYLAMINO)-2H-[1,2,4]TRIAZOLO[4,3-C]PYRIMIDIN-3-ONE
EnglishSynonyms: 7-ETHYL-5-(2-METHOXY-ETHYLAMINO)-2H-[1,2,4]TRIAZOLO[4,3-C]PYRIMIDIN-3-ONE
pro_mdlNumber: MFCD16993443
pro_acceptors: 7
pro_donors: 2
pro_smile: CCc1cc2n[nH]c(=O)n2c(n1)NCCOC
InChi: InChI=1S/C10H15N5O2/c1-3-7-6-8-13-14-10(16)15(8)9(12-7)11-4-5-17-2/h6H,3-5H2,1-2H3,(H,11,12)(H,14,16)
InChiKey: InChIKey=ZPOBHFWWAJYRSK-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.