7-ETHYL-5-(2-METHOXY-ETHYLAMINO)-8-METHYL-2H-[1,2,4]TRIAZOLO[4,3-C]PYRIMIDIN-3-ONE

pro_cas
pro_cdbregno
CCD03265190
pro_formula
C11 H17 N5 O2
pro_molWeight
251.288

basic_info

Product_Name: 7-ETHYL-5-(2-METHOXY-ETHYLAMINO)-8-METHYL-2H-[1,2,4]TRIAZOLO[4,3-C]PYRIMIDIN-3-ONE
EnglishSynonyms: 7-ETHYL-5-(2-METHOXY-ETHYLAMINO)-8-METHYL-2H-[1,2,4]TRIAZOLO[4,3-C]PYRIMIDIN-3-ONE
pro_mdlNumber: MFCD16993477
pro_acceptors: 7
pro_donors: 2
pro_smile: CCc1c(c2n[nH]c(=O)n2c(n1)NCCOC)C
InChi: InChI=1S/C11H17N5O2/c1-4-8-7(2)9-14-15-11(17)16(9)10(13-8)12-5-6-18-3/h4-6H2,1-3H3,(H,12,13)(H,15,17)
InChiKey: InChIKey=RTMIOJQHSAOGJP-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.