METHYL 2-METHYL-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)BENZOATE

pro_cas
478375-39-2
pro_cdbregno
CCD03268067
pro_formula
C15 H21 B O4
pro_molWeight
276.138

basic_info

Product_Name: METHYL 2-METHYL-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)BENZOATE
CAS: 478375-39-2
EnglishSynonyms: BENZOIC ACID, 2-METHYL-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-, METHYL ESTER ; METHYL 2-METHYL-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)BENZOATE ; 2-METHYL-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-BENZOIC ACID, METHYL ESTER ; 3-(METHOXYCARBONYL)-4-METHYLPHENYLBORONIC ACID, PINACOL ESTER
pro_mdlNumber: MFCD16996355
pro_acceptors: 4
pro_donors: 0
pro_smile: B1(OC(C(O1)(C)C)(C)C)c2ccc(c(c2)C(=O)OC)C
InChi: InChI=1S/C15H21BO4/c1-10-7-8-11(9-12(10)13(17)18-6)16-19-14(2,3)15(4,5)20-16/h7-9H,1-6H3
InChiKey: InChIKey=WBHBKJFHYGIUQU-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.