EMOLECULES 29260796

pro_cas
pro_cdbregno
CCD03282656
pro_formula
C16 H19 N O4
pro_molWeight
289.329

basic_info

Product_Name: EMOLECULES 29260796
EnglishSynonyms: EMOLECULES 29260796
pro_mdlNumber: MFCD17010968
pro_acceptors: 5
pro_donors: 0
pro_smile: COc1cc(ccc1OCC#CCN2CCOCC2)C=O
InChi: InChI=1S/C16H19NO4/c1-19-16-12-14(13-18)4-5-15(16)21-9-3-2-6-17-7-10-20-11-8-17/h4-5,12-13H,6-11H2,1H3
InChiKey: InChIKey=RPPYKIOMNIHGSC-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.