ETHYL 4-(4-FORMYLPHENOXY)BUTANOATE

pro_cas
92991-64-5
pro_cdbregno
CCD03282657
pro_formula
C13 H16 O4
pro_molWeight
236.265

basic_info

Product_Name: ETHYL 4-(4-FORMYLPHENOXY)BUTANOATE
CAS: 92991-64-5
EnglishSynonyms: ETHYL 4-(4-FORMYLPHENOXY)BUTANOATE
pro_mdlNumber: MFCD17010969
pro_acceptors: 4
pro_donors: 0
pro_smile: CCOC(=O)CCCOc1ccc(cc1)C=O
InChi: InChI=1S/C13H16O4/c1-2-16-13(15)4-3-9-17-12-7-5-11(10-14)6-8-12/h5-8,10H,2-4,9H2,1H3
InChiKey: InChIKey=QELMYVTXAHKHBG-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.