SYNTHON-LAB SL088829

pro_cas
pro_cdbregno
CCD03282658
pro_formula
C23 H16 Cl N O4 S2
pro_molWeight
469.967

basic_info

Product_Name: SYNTHON-LAB SL088829
EnglishSynonyms: SYNTHON-LAB SL088829
pro_mdlNumber: MFCD17010970
pro_acceptors: 5
pro_donors: 1
pro_smile: c1ccc(cc1)CCN2C(=O)/C(=C\c3ccc(o3)c4cccc(c4C(=O)O)Cl)/SC2=S
InChi: InChI=1S/C23H16ClNO4S2/c24-17-8-4-7-16(20(17)22(27)28)18-10-9-15(29-18)13-19-21(26)25(23(30)31-19)12-11-14-5-2-1-3-6-14/h1-10,13H,11-12H2,(H,27,28)/b19-13+
InChiKey: InChIKey=UNZQABQTBALJHX-CPNJWEJPSA-N

* If the product has intellectual property rights, a license granted is must or contact us.