(1,3,3,3-TETRACHLOROPROPYL)BENZENE

pro_cas
23691-27-2
pro_cdbregno
CCD03282659
pro_formula
C9 H8 Cl4
pro_molWeight
257.974

basic_info

Product_Name: (1,3,3,3-TETRACHLOROPROPYL)BENZENE
CAS: 23691-27-2
EnglishSynonyms: (1,3,3,3-TETRACHLOROPROPYL)BENZENE
pro_mdlNumber: MFCD17010971
pro_acceptors: 0
pro_donors: 0
pro_smile: c1ccc(cc1)C(CC(Cl)(Cl)Cl)Cl
InChi: InChI=1S/C9H8Cl4/c10-8(6-9(11,12)13)7-4-2-1-3-5-7/h1-5,8H,6H2
InChiKey: InChIKey=JJRCOEWDFJHOFK-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.