(1,3-DICHLOROPROPYL)BENZENE

pro_cas
14155-36-3
pro_cdbregno
CCD03282660
pro_formula
C9 H10 Cl2
pro_molWeight
189.084

basic_info

Product_Name: (1,3-DICHLOROPROPYL)BENZENE
CAS: 14155-36-3
EnglishSynonyms: (1,3-DICHLOROPROPYL)BENZENE
pro_mdlNumber: MFCD17010972
pro_acceptors: 0
pro_donors: 0
pro_smile: c1ccc(cc1)C(CCCl)Cl
InChi: InChI=1S/C9H10Cl2/c10-7-6-9(11)8-4-2-1-3-5-8/h1-5,9H,6-7H2
InChiKey: InChIKey=PGGFEXFACFLDGE-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.