C6 H12 N2 O

Basic Information

CAS: 185301-89-7
MDL Number.: MFCD17012152
H bond acceptor: 3
H bond donor: 2
Smile: CCC1CCNC(=O)N1
InChi: InChI=1S/C6H12N2O/c1-2-5-3-4-7-6(9)8-5/h5H,2-4H2,1H3,(H2,7,8,9)