C8 H8 N4 O2

Basic Information

CAS: 765857-95-2
MDL Number.: MFCD17013016
H bond acceptor: 6
H bond donor: 3
Smile: c1c(c2c([nH]1)c(ncn2)CN)C(=O)O
InChi: InChI=1S/C8H8N4O2/c9-1-5-7-6(12-3-11-5)4(2-10-7)8(13)14/h2-3,10H,1,9H2,(H,13,14)