C12 H7 N3 O4

Basic Information

MDL Number.: MFCD17015129
H bond acceptor: 7
H bond donor: 2
Smile: c1cc(ccc1C(=O)O)n2cc(c(=O)[nH]c2=O)C#N
InChi: InChI=1S/C12H7N3O4/c13-5-8-6-15(12(19)14-10(8)16)9-3-1-7(2-4-9)11(17)18/h1-4,6H,(H,17,18)(H,14,16,19)