C11 H8 N2 O2 S

Basic Information

CAS: 5268-74-6
MDL Number.: MFCD17015377
H bond acceptor: 4
H bond donor: 1
Smile: Cc1c(sc2n1c3ccccc3n2)C(=O)O
InChi: InChI=1S/C11H8N2O2S/c1-6-9(10(14)15)16-11-12-7-4-2-3-5-8(7)13(6)11/h2-5H,1H3,(H,14,15)