C10 H6 Cl N3 O

Basic Information

CAS: 53657-72-0
MDL Number.: MFCD17015715
H bond acceptor: 4
H bond donor: 1
Smile: c1cc(ccc1c2nc(c(o2)N)C#N)Cl
InChi: InChI=1S/C10H6ClN3O/c11-7-3-1-6(2-4-7)10-14-8(5-12)9(13)15-10/h1-4H,13H2