C6 H5 B Cl2 O3

Basic Information

CAS: 1256346-44-7
MDL Number.: MFCD17015749
H bond acceptor: 3
H bond donor: 3
Smile: B(c1cc(c(cc1Cl)Cl)O)(O)O
InChi: InChI=1S/C6H5BCl2O3/c8-4-2-5(9)6(10)1-3(4)7(11)12/h1-2,10-12H