2,4-DICHLORO-5-HYDROXYPHENYLBORONIC ACID

CAS No.
1256346-44-7
CCD No.
CCD03287188
Formula
C6 H5 B Cl2 O3
MolWeight
206.82

Basic Information

Product Name: 2,4-DICHLORO-5-HYDROXYPHENYLBORONIC ACID
CAS: 1256346-44-7
English Synonyms: BORONIC ACID, B-(2,4-DICHLORO-5-HYDROXYPHENYL)- ; B-(2,4-DICHLORO-5-HYDROXYPHENYL)-BORONIC ACID ; 2,4-DICHLORO-5-HYDROXYPHENYLBORONIC ACID
MDL Number.: MFCD17015749
H bond acceptor: 3
H bond donor: 3
Smile: B(c1cc(c(cc1Cl)Cl)O)(O)O
InChi: InChI=1S/C6H5BCl2O3/c8-4-2-5(9)6(10)1-3(4)7(11)12/h1-2,10-12H
InChiKey: InChIKey=QGQYVVHOORCAAV-UHFFFAOYSA-N