2,4-DICHLORO-5-ISOBUTOXYPHENYLBORONIC ACID

CAS No.
1256346-46-9
CCD No.
CCD03287192
Formula
C10 H13 B Cl2 O3
MolWeight
262.927

Basic Information

Product Name: 2,4-DICHLORO-5-ISOBUTOXYPHENYLBORONIC ACID
CAS: 1256346-46-9
English Synonyms: 2,4-DICHLORO-5-ISOBUTOXYPHENYLBORONIC ACID
MDL Number.: MFCD17015753
H bond acceptor: 3
H bond donor: 2
Smile: B(c1cc(c(cc1Cl)Cl)OCC(C)C)(O)O
InChi: InChI=1S/C10H13BCl2O3/c1-6(2)5-16-10-3-7(11(14)15)8(12)4-9(10)13/h3-4,6,14-15H,5H2,1-2H3
InChiKey: InChIKey=NIDCPTZXOXJCGW-UHFFFAOYSA-N