2,4-DICHLORO-5-(2-(DIMETHYLAMINO)ETHOXY)PHENYLBORONIC ACID

CAS No.
1256346-48-1
CCD No.
CCD03287194
Formula
C10 H14 B Cl2 N O3
MolWeight
277.942

Basic Information

Product Name: 2,4-DICHLORO-5-(2-(DIMETHYLAMINO)ETHOXY)PHENYLBORONIC ACID
CAS: 1256346-48-1
English Synonyms: 2,4-DICHLORO-5-(2-(DIMETHYLAMINO)ETHOXY)PHENYLBORONIC ACID
MDL Number.: MFCD17015755
H bond acceptor: 4
H bond donor: 2
Smile: B(c1cc(c(cc1Cl)Cl)OCCN(C)C)(O)O
InChi: InChI=1S/C10H14BCl2NO3/c1-14(2)3-4-17-10-5-7(11(15)16)8(12)6-9(10)13/h5-6,15-16H,3-4H2,1-2H3
InChiKey: InChIKey=UTMSRBAESHGWBY-UHFFFAOYSA-N