C9 H10 N4 O

Basic Information

CAS: 566926-37-2
MDL Number.: MFCD17232896
H bond acceptor: 5
H bond donor: 1
Smile: Cc1cnc(cn1)CNC(=O)CC#N
InChi: InChI=1S/C9H10N4O/c1-7-4-12-8(5-11-7)6-13-9(14)2-3-10/h4-5H,2,6H2,1H3,(H,13,14)