C9 H10 Cl F

Basic Information

CAS: 52063-61-3
MDL Number.: MFCD17273832
H bond acceptor: 0
H bond donor: 0
Smile: CC(Cc1ccccc1F)Cl
InChi: InChI=1S/C9H10ClF/c1-7(10)6-8-4-2-3-5-9(8)11/h2-5,7H,6H2,1H3