C14 H28 N2 O

Basic Information

MDL Number.: MFCD17388532
H bond acceptor: 3
H bond donor: 1
InChi: InChI=1S/C14H28N2O/c1-5-7-11(3)16(4)14(17)12-9-6-8-10(2)13(12)15/h10-13H,5-9,15H2,1-4H3