C12 H14 Br F O4

Basic Information

MDL Number.: MFCD17426886
H bond acceptor: 4
H bond donor: 1
Smile: CCOC(CCOc1ccc(cc1Br)F)C(=O)O
InChi: InChI=1S/C12H14BrFO4/c1-2-17-11(12(15)16)5-6-18-10-4-3-8(14)7-9(10)13/h3-4,7,11H,2,5-6H2,1H3,(H,15,16)