C5 H9 B N2 O2

Basic Information

CAS: 1146616-03-6
MDL Number.: MFCD18250638
H bond acceptor: 4
H bond donor: 2
Smile: B(c1cn(nc1C)C)(O)O
InChi: InChI=1S/C5H9BN2O2/c1-4-5(6(9)10)3-8(2)7-4/h3,9-10H,1-2H3