C5 H5 B F N O3

Basic Information

CAS: 1141886-36-3
MDL Number.: MFCD18384925
H bond acceptor: 4
H bond donor: 3
Smile: B(c1cc(c(nc1)O)F)(O)O
InChi: InChI=1S/C5H5BFNO3/c7-4-1-3(6(10)11)2-8-5(4)9/h1-2,10-11H,(H,8,9)