C7 H9 N O2 S

Basic Information

CAS: 61323-26-0
MDL Number.: MFCD18427704
H bond acceptor: 3
H bond donor: 0
Smile: CCOC(=O)c1c(scn1)C
InChi: InChI=1S/C7H9NO2S/c1-3-10-7(9)6-5(2)11-4-8-6/h4H,3H2,1-2H3


Safety information