C6 H10 O2

Basic Information

CAS: 71199-15-0
MDL Number.: MFCD18632734
H bond acceptor: 2
H bond donor: 1
Smile: CC1(CC1)CC(=O)O
InChi: InChI=1S/C6H10O2/c1-6(2-3-6)4-5(7)8/h2-4H2,1H3,(H,7,8)