C8 H5 N3

Basic Information

CAS: 6287-83-8
MDL Number.: MFCD18807947
H bond acceptor: 3
H bond donor: 1
Smile: c1cc2c(cc1C#N)[nH]cn2
InChi: InChI=1S/C8H5N3/c9-4-6-1-2-7-8(3-6)11-5-10-7/h1-3,5H,(H,10,11)