C9 H14 S

Basic Information

CAS: 147871-80-5
MDL Number.: MFCD18832321
H bond acceptor: 0
H bond donor: 0
Smile: CCc1c(ccs1)C(C)C
InChi: InChI=1S/C9H14S/c1-4-9-8(7(2)3)5-6-10-9/h5-7H,4H2,1-3H3