C7 H8 N2 O3

Basic Information

CAS: 220780-30-3
MDL Number.: MFCD18833188
H bond acceptor: 5
H bond donor: 0
Smile: CN(C)C(=O)c1cc(on1)C=O
InChi: InChI=1S/C7H8N2O3/c1-9(2)7(11)6-3-5(4-10)12-8-6/h3-4H,1-2H3