C7 H9 N O2 S2

Basic Information

CAS: 738619-80-2
MDL Number.: MFCD18836485
H bond acceptor: 3
H bond donor: 0
Smile: CCCOC(=O)c1c(scn1)S
InChi: InChI=1S/C7H9NO2S2/c1-2-3-10-6(9)5-7(11)12-4-8-5/h4,11H,2-3H2,1H3