C9 H7 B O3 S

Basic Information

CAS: 1182272-63-4
MDL Number.: MFCD20275084
H bond acceptor: 3
H bond donor: 2
Smile: B(c1cc2cc(ccc2s1)C=O)(O)O
InChi: InChI=1S/C9H7BO3S/c11-5-6-1-2-8-7(3-6)4-9(14-8)10(12)13/h1-5,12-13H