(1S,2S,3R,5S)-3-(7-(((1S,2S)-2-(3,4-DIFLUOROPHENYL)CYCLOPROPYL)AMINO)-5-(PROPYLTHIO)-3H-[1,2,3]TRIAZOLO[4,5-D]PYRIMIDIN-3-YL)-5-(2-HYDROXYETHOXY)CYCLOPENTANE-1,2-DIOL

pro_cas
274693-27-5
pro_cdbregno
CCD07366112
pro_formula
C23 H28 F2 N6 O4 S
pro_molWeight
522.574

basic_info

Product_Name: (1S,2S,3R,5S)-3-(7-(((1S,2S)-2-(3,4-DIFLUOROPHENYL)CYCLOPROPYL)AMINO)-5-(PROPYLTHIO)-3H-[1,2,3]TRIAZOLO[4,5-D]PYRIMIDIN-3-YL)-5-(2-HYDROXYETHOXY)CYCLOPENTANE-1,2-DIOL
CAS: 274693-27-5
EnglishSynonyms: (1S,2S,3R,5S)-3-(7-(((1S,2S)-2-(3,4-DIFLUOROPHENYL)CYCLOPROPYL)AMINO)-5-(PROPYLTHIO)-3H-[1,2,3]TRIAZOLO[4,5-D]PYRIMIDIN-3-YL)-5-(2-HYDROXYETHOXY)CYCLOPENTANE-1,2-DIOL
pro_mdlNumber: MFCD22377753
pro_acceptors: 10
pro_donors: 4
pro_smile: CCCSc1nc(c2c(n1)n(nn2)[C@@H]3C[C@@H]([C@H]([C@H]3O)O)OCCO)N[C@H]4C[C@H]4c5ccc(c(c5)F)F
InChi: InChI=1S/C23H28F2N6O4S/c1-2-7-36-23-27-21(26-15-9-12(15)11-3-4-13(24)14(25)8-11)18-22(28-23)31(30-29-18)16-10-17(35-6-5-32)20(34)19(16)33/h3-4,8,12,15-17,19-20,32-34H,2,5-7,9-10H2,1H3,(H,26,27,28)/t12-,15-,16+,17-,19-,20+/m0/s1
InChiKey: InChIKey=OEKWJQXRCDYSHL-OVGQVHOSSA-N

* If the product has intellectual property rights, a license granted is must or contact us.