BENZOIC ACID, 2-METHOXY-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-, METHYL ESTER

pro_cas
478375-37-0
pro_cdbregno
CCD07420859
pro_formula
C15 H21 B O5
pro_molWeight
292.137

basic_info

Product_Name: BENZOIC ACID, 2-METHOXY-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-, METHYL ESTER
CAS: 478375-37-0
EnglishSynonyms: BENZOIC ACID, 2-METHOXY-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-, METHYL ESTER ; 2-METHOXY-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-BENZOIC ACID, METHYL ESTER
pro_mdlNumber: MFCD22494011
pro_acceptors: 5
pro_donors: 0
pro_smile: B1(OC(C(O1)(C)C)(C)C)c2ccc(c(c2)C(=O)OC)OC
InChi: InChI=1S/C15H21BO5/c1-14(2)15(3,4)21-16(20-14)10-7-8-12(18-5)11(9-10)13(17)19-6/h7-9H,1-6H3
InChiKey: InChIKey=ZDOAPDUENFGHMI-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.