C13 H18 N2 O3

Basic Information

CAS: 945652-12-0
MDL Number.: MFCD22495389
H bond acceptor: 5
H bond donor: 2
Smile: CCOC(=O)/C(=N/O)/c1ccccc1CCNC
InChi: InChI=1S/C13H18N2O3/c1-3-18-13(16)12(15-17)11-7-5-4-6-10(11)8-9-14-2/h4-7,14,17H,3,8-9H2,1-2H3/b15-12+