C8 H10 N2 O2

Basic Information

CAS: 2556-36-7
MDL Number.: MFCD00010372
H bond acceptor: 4
H bond donor: 0
Smile: C1CC(CCC1N=C=O)N=C=O
InChi: InChI=1S/C8H10N2O2/c11-5-9-7-1-2-8(4-3-7)10-6-12/h7-8H,1-4H2