C8 H11 N O2

Basic Information

CAS: 23466-29-7
MDL Number.: MFCD00030404
H bond acceptor: 3
H bond donor: 2
Smile: CCc1c[nH]c(c1C)C(=O)O
InChi: InChI=1S/C8H11NO2/c1-3-6-4-9-7(5(6)2)8(10)11/h4,9H,3H2,1-2H3,(H,10,11)