C14 H18 O

Basic Information

CAS: 13586-68-0
MDL Number.: MFCD00134501
H bond acceptor: 1
H bond donor: 0
Smile: C/C(=C\c1ccc(cc1)C(C)(C)C)/C=O
InChi: InChI=1S/C14H18O/c1-11(10-15)9-12-5-7-13(8-6-12)14(2,3)4/h5-10H,1-4H3/b11-9+