C20 H21 N O5

Basic Information

CAS: 34231-26-0
MDL Number.: MFCD01027266
H bond acceptor: 6
H bond donor: 3
Smile: c1ccc2c(c1)C(=O)c3c(cc(c(c3C2=O)N)OCCCCCCO)O
InChi: InChI=1S/C20H21NO5/c21-18-15(26-10-6-2-1-5-9-22)11-14(23)16-17(18)20(25)13-8-4-3-7-12(13)19(16)24/h3-4,7-8,11,22-23H,1-2,5-6,9-10,21H2