C12 H14 F N O2

Basic Information

CAS: 637020-68-9
MDL Number.: MFCD04115810
H bond acceptor: 3
H bond donor: 2
Smile: c1cc(ccc1C[C@]2(CCCN2)C(=O)O)F
InChi: InChI=1S/C12H14FNO2/c13-10-4-2-9(3-5-10)8-12(11(15)16)6-1-7-14-12/h2-5,14H,1,6-8H2,(H,15,16)/t12-/m1/s1