N'-[(3,5-DICHLOROPHENYL)METHYLIDENE]-2-(1,3-DIMETHYL-2,6-DIOXO-1,2,3,6-TETRAHYDRO-7H-PURIN-7-YL)ACETOHYDRAZIDE

pro_cas
pro_cdbregno
CCD08266670
pro_formula
C16 H14 Cl2 N6 O3
pro_molWeight
409.232

basic_info

Product_Name: N'-[(3,5-DICHLOROPHENYL)METHYLIDENE]-2-(1,3-DIMETHYL-2,6-DIOXO-1,2,3,6-TETRAHYDRO-7H-PURIN-7-YL)ACETOHYDRAZIDE
EnglishSynonyms: N'-[(3,5-DICHLOROPHENYL)METHYLIDENE]-2-(1,3-DIMETHYL-2,6-DIOXO-1,2,3,6-TETRAHYDRO-7H-PURIN-7-YL)ACETOHYDRAZIDE
pro_mdlNumber: MFCD16631254
pro_acceptors: 9
pro_donors: 1
pro_smile: Cn1c2c(c(=O)n(c1=O)C)n(cn2)CC(=O)N/N=C/c3cc(cc(c3)Cl)Cl
InChi: InChI=1S/C16H14Cl2N6O3/c1-22-14-13(15(26)23(2)16(22)27)24(8-19-14)7-12(25)21-20-6-9-3-10(17)5-11(18)4-9/h3-6,8H,7H2,1-2H3,(H,21,25)/b20-6+
InChiKey: InChIKey=MWKHCLUVDBHUMK-CGOBSMCZSA-N

* If the product has intellectual property rights, a license granted is must or contact us.