2-CHLORO-6-FLUORONAPHTHALENE

pro_cas
59079-71-9
pro_cdbregno
CCD08269116
pro_formula
C10 H6 Cl F
pro_molWeight
180.608

basic_info

Product_Name: 2-CHLORO-6-FLUORONAPHTHALENE
CAS: 59079-71-9
EnglishSynonyms: 2-CHLORO-6-FLUORONAPHTHALENE
pro_mdlNumber: MFCD17012582
pro_acceptors: 0
pro_donors: 0
pro_smile: c1cc(cc2c1cc(cc2)Cl)F
InChi: InChI=1S/C10H6ClF/c11-9-3-1-8-6-10(12)4-2-7(8)5-9/h1-6H
InChiKey: InChIKey=QWAOODAKUAYDQK-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.