(-)-P-MENTH-1-EN-3-ONE

pro_cas
4573-50-6
pro_cdbregno
CCD08283651
pro_formula
C10 H16 O
pro_molWeight
152.235

basic_info

Product_Name: (-)-P-MENTH-1-EN-3-ONE
CAS: 4573-50-6
EnglishSynonyms: (-)-PIPERITONE ; (-)-P-MENTH-1-EN-3-ONE
pro_mdlNumber: MFCD23380212
pro_acceptors: 1
pro_donors: 0
pro_smile: CC1=CC(=O)[C@H](CC1)C(C)C
InChi: InChI=1S/C10H16O/c1-7(2)9-5-4-8(3)6-10(9)11/h6-7,9H,4-5H2,1-3H3/t9-/m1/s1
InChiKey: InChIKey=YSTPAHQEHQSRJD-SECBINFHSA-N

* If the product has intellectual property rights, a license granted is must or contact us.