methyl 3-aminoquinoline-6-carboxylate

pro_cas
pro_cdbregno
CCD08285742
pro_formula
C11H10N2O2
pro_molWeight
202.2093

basic_info

Product_Name: methyl 3-aminoquinoline-6-carboxylate
EnglishSynonyms: METHYL 3-AMINOQUINOLINE-6-CARBOXYLATE
pro_acceptors: 0
pro_donors: 0
pro_smile: NC=1C=NC2=CC=C(C=C2C1)C(=O)OC
InChi: InChI=1S/C11H10N2O2/c1-15-11(14)7-2-3-10-8(4-7)5-9(12)6-13-10/h2-6H,12H2,1H3
InChiKey: InChIKey=ZUSFPZQYSBSCDL-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.