(R)-3-amino-3-(4-isopropylphenyl)propan-1-ol

pro_cas
1213359-92-2
pro_cdbregno
CCD08285988
pro_formula
C12H19NO
pro_molWeight
193.2854

basic_info

Product_Name: (R)-3-amino-3-(4-isopropylphenyl)propan-1-ol
CAS: 1213359-92-2
EnglishSynonyms: (R)-3-AMINO-3-(4-ISOPROPYLPHENYL)PROPAN-1-OL
pro_acceptors: 0
pro_donors: 0
pro_smile: N[C@H](CCO)C1=CC=C(C=C1)C(C)C
InChi: InChI=1S/C12H19NO/c1-9(2)10-3-5-11(6-4-10)12(13)7-8-14/h3-6,9,12,14H,7-8,13H2,1-2H3/t12-/m1/s1
InChiKey: InChIKey=TVSIYSBCFQVGGD-GFCCVEGCSA-N

property

secure_info

* If the product has intellectual property rights, a license granted is must or contact us.