(S)3-amino-3-(4-isobutylphenyl)propan-1-ol

pro_cas
1213463-28-5
pro_cdbregno
CCD08285989
pro_formula
C13H21NO
pro_molWeight
207.3119

basic_info

Product_Name: (S)3-amino-3-(4-isobutylphenyl)propan-1-ol
CAS: 1213463-28-5
EnglishSynonyms: (S)3-AMINO-3-(4-ISOBUTYLPHENYL)PROPAN-1-OL
pro_acceptors: 0
pro_donors: 0
pro_smile: N[C@@H](CCO)C1=CC=C(C=C1)CC(C)C
InChi: InChI=1S/C13H21NO/c1-10(2)9-11-3-5-12(6-4-11)13(14)7-8-15/h3-6,10,13,15H,7-9,14H2,1-2H3/t13-/m0/s1
InChiKey: InChIKey=HLAQDBXAZQWHPF-ZDUSSCGKSA-N

property

secure_info

* If the product has intellectual property rights, a license granted is must or contact us.