ethyl 6-bromo-5-hydroxy-1-methyl-2-((p-tolylthiomethylamino)methyl)-1H-indole-3-carboxylate

pro_cas
1704066-64-7
pro_cdbregno
CCD08289401
pro_formula
C21H23BrN2O3S
pro_molWeight
463.388

basic_info

Product_Name: ethyl 6-bromo-5-hydroxy-1-methyl-2-((p-tolylthiomethylamino)methyl)-1H-indole-3-carboxylate
CAS: 1704066-64-7
EnglishSynonyms: ETHYL 6-BROMO-5-HYDROXY-1-METHYL-2-((P-TOLYLTHIOMETHYLAMINO)METHYL)-1H-INDOLE-3-CARBOXYLATE
pro_acceptors: 0
pro_donors: 0
pro_smile: BrC1=C(C=C2C(=C(N(C2=C1)C)CNCSC1=CC=C(C=C1)C)C(=O)OCC)O
InChi: InChI=1S/C21H23BrN2O3S/c1-4-27-21(26)20-15-9-19(25)16(22)10-17(15)24(3)18(20)11-23-12-28-14-7-5-13(2)6-8-14/h5-10,23,25H,4,11-12H2,1-3H3
InChiKey: InChIKey=KQBGKEBHVDLQIF-UHFFFAOYSA-N

property

secure_info

* If the product has intellectual property rights, a license granted is must or contact us.