1-(6-Methoxy-2-(methylthio)pyrimidin-4-yl)piperidine-2-carboxylic acid

pro_cas
1353945-73-9
pro_cdbregno
CCD08291237
pro_formula
C12H17N3O3S
pro_molWeight
283.347

basic_info

Product_Name: 1-(6-Methoxy-2-(methylthio)pyrimidin-4-yl)piperidine-2-carboxylic acid
CAS: 1353945-73-9
EnglishSynonyms: 1-(6-METHOXY-2-(METHYLTHIO)PYRIMIDIN-4-YL)PIPERIDINE-2-CARBOXYLIC ACID
pro_acceptors: 0
pro_donors: 0
pro_smile: COC1=CC(=NC(=N1)SC)N1C(CCCC1)C(=O)O
InChi: InChI=1S/C12H17N3O3S/c1-18-10-7-9(13-12(14-10)19-2)15-6-4-3-5-8(15)11(16)17/h7-8H,3-6H2,1-2H3,(H,16,17)
InChiKey: InChIKey=AIEWMEUWZXHARP-UHFFFAOYSA-N

property

secure_info

* If the product has intellectual property rights, a license granted is must or contact us.