1-(6-Methoxy-2-(methylthio)pyrimidin-4-yl)-N-methylpiperidin-4-amine hydrochloride

pro_cas
1353947-62-2
pro_cdbregno
CCD08291277
pro_formula
C12H21ClN4OS
pro_molWeight
304.839

basic_info

Product_Name: 1-(6-Methoxy-2-(methylthio)pyrimidin-4-yl)-N-methylpiperidin-4-amine hydrochloride
CAS: 1353947-62-2
EnglishSynonyms: 1-(6-METHOXY-2-(METHYLTHIO)PYRIMIDIN-4-YL)-N-METHYLPIPERIDIN-4-AMINE HYDROCHLORIDE
pro_acceptors: 0
pro_donors: 0
pro_smile: Cl.COC1=CC(=NC(=N1)SC)N1CCC(CC1)NC
InChi: InChI=1S/C12H20N4OS.ClH/c1-13-9-4-6-16(7-5-9)10-8-11(17-2)15-12(14-10)18-3;/h8-9,13H,4-7H2,1-3H3;1H
InChiKey: InChIKey=ABINGMSXYMYLPW-UHFFFAOYSA-N

property

secure_info

* If the product has intellectual property rights, a license granted is must or contact us.