(S)-1-(6-Methoxy-2-(methylthio)pyrimidin-4-yl)pyrrolidin-3-ol

pro_cas
1354018-67-9
pro_cdbregno
CCD08291782
pro_formula
C10H15N3O2S
pro_molWeight
241.31

basic_info

Product_Name: (S)-1-(6-Methoxy-2-(methylthio)pyrimidin-4-yl)pyrrolidin-3-ol
CAS: 1354018-67-9
EnglishSynonyms: (S)-1-(6-METHOXY-2-(METHYLTHIO)PYRIMIDIN-4-YL)PYRROLIDIN-3-OL
pro_acceptors: 0
pro_donors: 0
pro_smile: COC1=CC(=NC(=N1)SC)N1C[C@H](CC1)O
InChi: InChI=1S/C10H15N3O2S/c1-15-9-5-8(11-10(12-9)16-2)13-4-3-7(14)6-13/h5,7,14H,3-4,6H2,1-2H3/t7-/m0/s1
InChiKey: InChIKey=ALGHQWHZQKGRLF-ZETCQYMHSA-N

property

secure_info

* If the product has intellectual property rights, a license granted is must or contact us.