(alphaS)-alpha-[[[Methyl[[2-(1-methylethyl)-4-thiazolyl]methyl]amino]carbonyl]amino]-4-morpholinebutanoic acid methyl ester

pro_cas
1004316-91-9
pro_cdbregno
CCD08293104
pro_formula
C18H30N4O4S
pro_molWeight
398.52

basic_info

Product_Name: (alphaS)-alpha-[[[Methyl[[2-(1-methylethyl)-4-thiazolyl]methyl]amino]carbonyl]amino]-4-morpholinebutanoic acid methyl ester
CAS: 1004316-91-9
EnglishSynonyms: (ALPHAS)-ALPHA-[[[METHYL[[2-(1-METHYLETHYL)-4-THIAZOLYL]METHYL]AMINO]CARBONYL]AMINO]-4-MORPHOLINEBUTANOIC ACID METHYL ESTER
pro_acceptors: 0
pro_donors: 0
pro_smile: COC([C@H](CCN1CCOCC1)NC(=O)N(CC=1N=C(SC1)C(C)C)C)=O
InChi: InChI=1S/C18H30N4O4S/c1-13(2)16-19-14(12-27-16)11-21(3)18(24)20-15(17(23)25-4)5-6-22-7-9-26-10-8-22/h12-13,15H,5-11H2,1-4H3,(H,20,24)/t15-/m0/s1
InChiKey: InChIKey=CSTZTQPURGFEOQ-HNNXBMFYSA-N

property

secure_info

* If the product has intellectual property rights, a license granted is must or contact us.