N-(4-fluoro-2-Methoxy-5-nitrophenyl)-4-(1-Methylindol-3-yl)pyriMidin-2-aMine

pro_cas
1421372-94-2
pro_cdbregno
CCD08293422
pro_formula
C20H16FN5O3
pro_molWeight
393.3711

basic_info

Product_Name: N-(4-fluoro-2-Methoxy-5-nitrophenyl)-4-(1-Methylindol-3-yl)pyriMidin-2-aMine
CAS: 1421372-94-2
EnglishSynonyms: N-(4-FLUORO-2-METHOXY-5-NITROPHENYL)-4-(1-METHYLINDOL-3-YL)PYRIMIDIN-2-AMINE
pro_acceptors: 0
pro_donors: 0
pro_smile: FC1=CC(=C(C=C1[N+](=O)[O-])NC1=NC=CC(=N1)C1=CN(C2=CC=CC=C12)C)OC
InChi: InChI=1S/C20H16FN5O3/c1-25-11-13(12-5-3-4-6-17(12)25)15-7-8-22-20(23-15)24-16-10-18(26(27)28)14(21)9-19(16)29-2/h3-11H,1-2H3,(H,22,23,24)
InChiKey: InChIKey=SZTYQQYYIMVETL-UHFFFAOYSA-N

property

secure_info

* If the product has intellectual property rights, a license granted is must or contact us.