rel-(6S,7R)-2-Amino-4,5,6,7-tetrahydro-6-(propylamino)-7-benzothiazolol

pro_cas
1246818-51-8
pro_cdbregno
CCD08299251
pro_formula
C10H17N3OS
pro_molWeight
227.326

basic_info

Product_Name: rel-(6S,7R)-2-Amino-4,5,6,7-tetrahydro-6-(propylamino)-7-benzothiazolol
CAS: 1246818-51-8
EnglishSynonyms: REL-(6S,7R)-2-AMINO-4,5,6,7-TETRAHYDRO-6-(PROPYLAMINO)-7-BENZOTHIAZOLOL
pro_acceptors: 0
pro_donors: 0
pro_smile: NC=1SC2=C(N1)CC[C@@H]([C@H]2O)NCCC
InChi: InChI=1S/C10H17N3OS/c1-2-5-12-6-3-4-7-9(8(6)14)15-10(11)13-7/h6,8,12,14H,2-5H2,1H3,(H2,11,13)/t6-,8+/m0/s1
InChiKey: InChIKey=UWNDKVURLHPSSG-POYBYMJQSA-N

property

secure_info

* If the product has intellectual property rights, a license granted is must or contact us.